About isothiocyanic acid;3-trimethoxysilylpropan-1-amine
isothiocyanic acid;3-trimethoxysilylpropan-1-amine (PubChem CID 172722891) has the molecular formula C7H18N2O3SSi
and a molecular weight of 238.38 g/mol. Its IUPAC name is isothiocyanic acid;3-trimethoxysilylpropan-1-amine.
Molecular Properties
| Compound Name | isothiocyanic acid;3-trimethoxysilylpropan-1-amine |
| PubChem CID | 172722891 |
| Molecular Formula | C7H18N2O3SSi |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | isothiocyanic acid;3-trimethoxysilylpropan-1-amine |
| SMILES | CO[Si](CCCN)(OC)OC.N=C=S |
| InChI | InChI=1S/C6H17NO3Si.CHNS/c1-8-11(9-2,10-3)6-4-5-7;2-1-3/h4-7H2,1-3H3;2H |
| InChIKey | GTFQQHDFIJLJEO-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 77.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze isothiocyanic acid;3-trimethoxysilylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isothiocyanic acid;3-trimethoxysilylpropan-1-amine?
The IUPAC name of isothiocyanic acid;3-trimethoxysilylpropan-1-amine (CID 172722891) is isothiocyanic acid;3-trimethoxysilylpropan-1-amine.
What is the SMILES notation for isothiocyanic acid;3-trimethoxysilylpropan-1-amine?
The canonical SMILES for isothiocyanic acid;3-trimethoxysilylpropan-1-amine is CO[Si](CCCN)(OC)OC.N=C=S.
What is the InChIKey of isothiocyanic acid;3-trimethoxysilylpropan-1-amine?
The InChIKey is GTFQQHDFIJLJEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H17NO3Si.CHNS/c1-8-11(9-2,10-3)6-4-5-7;2-1-3/h4-7H2,1-3H3;2H.
What are the key properties of isothiocyanic acid;3-trimethoxysilylpropan-1-amine?
isothiocyanic acid;3-trimethoxysilylpropan-1-amine has a molecular weight of 238.38 g/mol, XLogP of 0.88, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for isothiocyanic acid;3-trimethoxysilylpropan-1-amine is sourced from PubChem (CID 172722891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).