About 3-N-(4-aminobutan-2-yl)propane-1,1,3-triamine
3-N-(4-aminobutan-2-yl)propane-1,1,3-triamine (PubChem CID 154520906) has the molecular formula C7H20N4
and a molecular weight of 160.26 g/mol. Its IUPAC name is 3-N-(4-aminobutan-2-yl)propane-1,1,3-triamine.
Molecular Properties
| Compound Name | 3-N-(4-aminobutan-2-yl)propane-1,1,3-triamine |
| PubChem CID | 154520906 |
| Molecular Formula | C7H20N4 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.17 |
| IUPAC Name | 3-N-(4-aminobutan-2-yl)propane-1,1,3-triamine |
| SMILES | CC(CCN)NCCC(N)N |
| InChI | InChI=1S/C7H20N4/c1-6(2-4-8)11-5-3-7(9)10/h6-7,11H,2-5,8-10H2,1H3 |
| InChIKey | UCMUOVRCDHFJLX-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 90.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-N-(4-aminobutan-2-yl)propane-1,1,3-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-(4-aminobutan-2-yl)propane-1,1,3-triamine?
The IUPAC name of 3-N-(4-aminobutan-2-yl)propane-1,1,3-triamine (CID 154520906) is 3-N-(4-aminobutan-2-yl)propane-1,1,3-triamine.
What is the SMILES notation for 3-N-(4-aminobutan-2-yl)propane-1,1,3-triamine?
The canonical SMILES for 3-N-(4-aminobutan-2-yl)propane-1,1,3-triamine is CC(CCN)NCCC(N)N.
What is the InChIKey of 3-N-(4-aminobutan-2-yl)propane-1,1,3-triamine?
The InChIKey is UCMUOVRCDHFJLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H20N4/c1-6(2-4-8)11-5-3-7(9)10/h6-7,11H,2-5,8-10H2,1H3.
What are the key properties of 3-N-(4-aminobutan-2-yl)propane-1,1,3-triamine?
3-N-(4-aminobutan-2-yl)propane-1,1,3-triamine has a molecular weight of 160.26 g/mol, XLogP of -1.05, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-(4-aminobutan-2-yl)propane-1,1,3-triamine is sourced from PubChem (CID 154520906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).