C7H20N4 — CID 154520906
3-N-(4-aminobutan-2-yl)propane-1,1,3-triamine (PubChem CID 154520906) has the molecular formula C7H20N4 and a molecular weight of 160.26 g/mol. Its IUPAC name is 3-N-(4-aminobutan-2-yl)propane-1,1,3-triamine.
| Compound Name | 3-N-(4-aminobutan-2-yl)propane-1,1,3-triamine |
|---|---|
| PubChem CID | 154520906 |
| Molecular Formula | C7H20N4 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.17 |
| IUPAC Name | 3-N-(4-aminobutan-2-yl)propane-1,1,3-triamine |
| SMILES | CC(CCN)NCCC(N)N |
| InChI | InChI=1S/C7H20N4/c1-6(2-4-8)11-5-3-7(9)10/h6-7,11H,2-5,8-10H2,1H3 |
| InChIKey | UCMUOVRCDHFJLX-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 90.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|