C15H38N2 — CID 143412122
ethane;3-N-(2-ethylpentyl)butane-1,3-diamine (PubChem CID 143412122) has the molecular formula C15H38N2 and a molecular weight of 246.48 g/mol. Its IUPAC name is ethane;3-N-(2-ethylpentyl)butane-1,3-diamine.
| Compound Name | ethane;3-N-(2-ethylpentyl)butane-1,3-diamine |
|---|---|
| PubChem CID | 143412122 |
| Molecular Formula | C15H38N2 |
| Molecular Weight | 246.48 g/mol |
| Exact Mass | 246.30 |
| IUPAC Name | ethane;3-N-(2-ethylpentyl)butane-1,3-diamine |
| SMILES | CC.CC.CCCC(CC)CNC(C)CCN |
| InChI | InChI=1S/C11H26N2.2C2H6/c1-4-6-11(5-2)9-13-10(3)7-8-12;2*1-2/h10-11,13H,4-9,12H2,1-3H3;2*1-2H3 |
| InChIKey | PRBWGPHFNXQYLI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |