About propan-2-ol;dihydrate;trihydrochloride
propan-2-ol;dihydrate;trihydrochloride (PubChem CID 172856873) has the molecular formula C3H15Cl3O3
and a molecular weight of 205.51 g/mol. Its IUPAC name is propan-2-ol;dihydrate;trihydrochloride.
Molecular Properties
| Compound Name | propan-2-ol;dihydrate;trihydrochloride |
| PubChem CID | 172856873 |
| Molecular Formula | C3H15Cl3O3 |
| Molecular Weight | 205.51 g/mol |
| Exact Mass | 204.01 |
| IUPAC Name | propan-2-ol;dihydrate;trihydrochloride |
| SMILES | CC(C)O.Cl.Cl.Cl.O.O |
| InChI | InChI=1S/C3H8O.3ClH.2H2O/c1-3(2)4;;;;;/h3-4H,1-2H3;3*1H;2*1H2 |
| InChIKey | YVBIUCHLMORGRO-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 83.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.51 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze propan-2-ol;dihydrate;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-ol;dihydrate;trihydrochloride?
The IUPAC name of propan-2-ol;dihydrate;trihydrochloride (CID 172856873) is propan-2-ol;dihydrate;trihydrochloride.
What is the SMILES notation for propan-2-ol;dihydrate;trihydrochloride?
The canonical SMILES for propan-2-ol;dihydrate;trihydrochloride is CC(C)O.Cl.Cl.Cl.O.O.
What is the InChIKey of propan-2-ol;dihydrate;trihydrochloride?
The InChIKey is YVBIUCHLMORGRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O.3ClH.2H2O/c1-3(2)4;;;;;/h3-4H,1-2H3;3*1H;2*1H2.
What are the key properties of propan-2-ol;dihydrate;trihydrochloride?
propan-2-ol;dihydrate;trihydrochloride has a molecular weight of 205.51 g/mol, XLogP of 0.00, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-ol;dihydrate;trihydrochloride is sourced from PubChem (CID 172856873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).