About azane;propan-2-ol;hydrochloride
azane;propan-2-ol;hydrochloride (PubChem CID 88500405) has the molecular formula C3H12ClNO
and a molecular weight of 113.59 g/mol. Its IUPAC name is azane;propan-2-ol;hydrochloride.
Molecular Properties
| Compound Name | azane;propan-2-ol;hydrochloride |
| PubChem CID | 88500405 |
| Molecular Formula | C3H12ClNO |
| Molecular Weight | 113.59 g/mol |
| Exact Mass | 113.06 |
| IUPAC Name | azane;propan-2-ol;hydrochloride |
| SMILES | CC(C)O.Cl.N |
| InChI | InChI=1S/C3H8O.ClH.H3N/c1-3(2)4;;/h3-4H,1-2H3;1H;1H3 |
| InChIKey | OZMCWWGXJZFBLQ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 55.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.59 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azane;propan-2-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;propan-2-ol;hydrochloride?
The IUPAC name of azane;propan-2-ol;hydrochloride (CID 88500405) is azane;propan-2-ol;hydrochloride.
What is the SMILES notation for azane;propan-2-ol;hydrochloride?
The canonical SMILES for azane;propan-2-ol;hydrochloride is CC(C)O.Cl.N.
What is the InChIKey of azane;propan-2-ol;hydrochloride?
The InChIKey is OZMCWWGXJZFBLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O.ClH.H3N/c1-3(2)4;;/h3-4H,1-2H3;1H;1H3.
What are the key properties of azane;propan-2-ol;hydrochloride?
azane;propan-2-ol;hydrochloride has a molecular weight of 113.59 g/mol, XLogP of 0.97, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;propan-2-ol;hydrochloride is sourced from PubChem (CID 88500405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).