About lutetium;propan-2-ol
lutetium;propan-2-ol (PubChem CID 174898431) has the molecular formula C3H8LuO
and a molecular weight of 235.06 g/mol. Its IUPAC name is lutetium;propan-2-ol.
Molecular Properties
| Compound Name | lutetium;propan-2-ol |
| PubChem CID | 174898431 |
| Molecular Formula | C3H8LuO |
| Molecular Weight | 235.06 g/mol |
| Exact Mass | 235.00 |
| IUPAC Name | lutetium;propan-2-ol |
| SMILES | CC(C)O.[Lu] |
| InChI | InChI=1S/C3H8O.Lu/c1-3(2)4;/h3-4H,1-2H3; |
| InChIKey | WCUZLVGRTMRAQO-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.06 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze lutetium;propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lutetium;propan-2-ol?
The IUPAC name of lutetium;propan-2-ol (CID 174898431) is lutetium;propan-2-ol.
What is the SMILES notation for lutetium;propan-2-ol?
The canonical SMILES for lutetium;propan-2-ol is CC(C)O.[Lu].
What is the InChIKey of lutetium;propan-2-ol?
The InChIKey is WCUZLVGRTMRAQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O.Lu/c1-3(2)4;/h3-4H,1-2H3;.
What are the key properties of lutetium;propan-2-ol?
lutetium;propan-2-ol has a molecular weight of 235.06 g/mol, XLogP of 0.39, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lutetium;propan-2-ol is sourced from PubChem (CID 174898431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).