About butane-1,3-diol;[4-(hydroxymethyl)cyclohexyl]methanol
butane-1,3-diol;[4-(hydroxymethyl)cyclohexyl]methanol (PubChem CID 174804124) has the molecular formula C12H26O4
and a molecular weight of 234.34 g/mol. Its IUPAC name is butane-1,3-diol;[4-(hydroxymethyl)cyclohexyl]methanol.
Molecular Properties
| Compound Name | butane-1,3-diol;[4-(hydroxymethyl)cyclohexyl]methanol |
| PubChem CID | 174804124 |
| Molecular Formula | C12H26O4 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | butane-1,3-diol;[4-(hydroxymethyl)cyclohexyl]methanol |
| SMILES | CC(O)CCO.OCC1CCC(CO)CC1 |
| InChI | InChI=1S/C8H16O2.C4H10O2/c9-5-7-1-2-8(6-10)4-3-7;1-4(6)2-3-5/h7-10H,1-6H2;4-6H,2-3H2,1H3 |
| InChIKey | MNKXMVJDGLXPCQ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze butane-1,3-diol;[4-(hydroxymethyl)cyclohexyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane-1,3-diol;[4-(hydroxymethyl)cyclohexyl]methanol?
The IUPAC name of butane-1,3-diol;[4-(hydroxymethyl)cyclohexyl]methanol (CID 174804124) is butane-1,3-diol;[4-(hydroxymethyl)cyclohexyl]methanol.
What is the SMILES notation for butane-1,3-diol;[4-(hydroxymethyl)cyclohexyl]methanol?
The canonical SMILES for butane-1,3-diol;[4-(hydroxymethyl)cyclohexyl]methanol is CC(O)CCO.OCC1CCC(CO)CC1.
What is the InChIKey of butane-1,3-diol;[4-(hydroxymethyl)cyclohexyl]methanol?
The InChIKey is MNKXMVJDGLXPCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2.C4H10O2/c9-5-7-1-2-8(6-10)4-3-7;1-4(6)2-3-5/h7-10H,1-6H2;4-6H,2-3H2,1H3.
What are the key properties of butane-1,3-diol;[4-(hydroxymethyl)cyclohexyl]methanol?
butane-1,3-diol;[4-(hydroxymethyl)cyclohexyl]methanol has a molecular weight of 234.34 g/mol, XLogP of 0.53, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butane-1,3-diol;[4-(hydroxymethyl)cyclohexyl]methanol is sourced from PubChem (CID 174804124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).