About cyclohexane;[4-(hydroxymethyl)cyclohexyl]methanol;methanol
cyclohexane;[4-(hydroxymethyl)cyclohexyl]methanol;methanol (PubChem CID 19012640) has the molecular formula C16H36O4
and a molecular weight of 292.46 g/mol. Its IUPAC name is cyclohexane;[4-(hydroxymethyl)cyclohexyl]methanol;methanol.
Molecular Properties
| Compound Name | cyclohexane;[4-(hydroxymethyl)cyclohexyl]methanol;methanol |
| PubChem CID | 19012640 |
| Molecular Formula | C16H36O4 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.26 |
| IUPAC Name | cyclohexane;[4-(hydroxymethyl)cyclohexyl]methanol;methanol |
| SMILES | C1CCCCC1.CO.CO.OCC1CCC(CO)CC1 |
| InChI | InChI=1S/C8H16O2.C6H12.2CH4O/c9-5-7-1-2-8(6-10)4-3-7;1-2-4-6-5-3-1;2*1-2/h7-10H,1-6H2;1-6H2;2*2H,1H3 |
| InChIKey | SKAVEYIADGPFAI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cyclohexane;[4-(hydroxymethyl)cyclohexyl]methanol;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane;[4-(hydroxymethyl)cyclohexyl]methanol;methanol?
The IUPAC name of cyclohexane;[4-(hydroxymethyl)cyclohexyl]methanol;methanol (CID 19012640) is cyclohexane;[4-(hydroxymethyl)cyclohexyl]methanol;methanol.
What is the SMILES notation for cyclohexane;[4-(hydroxymethyl)cyclohexyl]methanol;methanol?
The canonical SMILES for cyclohexane;[4-(hydroxymethyl)cyclohexyl]methanol;methanol is C1CCCCC1.CO.CO.OCC1CCC(CO)CC1.
What is the InChIKey of cyclohexane;[4-(hydroxymethyl)cyclohexyl]methanol;methanol?
The InChIKey is SKAVEYIADGPFAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2.C6H12.2CH4O/c9-5-7-1-2-8(6-10)4-3-7;1-2-4-6-5-3-1;2*1-2/h7-10H,1-6H2;1-6H2;2*2H,1H3.
What are the key properties of cyclohexane;[4-(hydroxymethyl)cyclohexyl]methanol;methanol?
cyclohexane;[4-(hydroxymethyl)cyclohexyl]methanol;methanol has a molecular weight of 292.46 g/mol, XLogP of 2.34, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane;[4-(hydroxymethyl)cyclohexyl]methanol;methanol is sourced from PubChem (CID 19012640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).