About cyclohexylmethanol;sulfuric acid
cyclohexylmethanol;sulfuric acid (PubChem CID 71362926) has the molecular formula C14H30O6S
and a molecular weight of 326.46 g/mol. Its IUPAC name is cyclohexylmethanol;sulfuric acid.
Molecular Properties
| Compound Name | cyclohexylmethanol;sulfuric acid |
| PubChem CID | 71362926 |
| Molecular Formula | C14H30O6S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | cyclohexylmethanol;sulfuric acid |
| SMILES | O=S(=O)(O)O.OCC1CCCCC1.OCC1CCCCC1 |
| InChI | InChI=1S/2C7H14O.H2O4S/c2*8-6-7-4-2-1-3-5-7;1-5(2,3)4/h2*7-8H,1-6H2;(H2,1,2,3,4) |
| InChIKey | DNJORSZQDNDXFO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze cyclohexylmethanol;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexylmethanol;sulfuric acid?
The IUPAC name of cyclohexylmethanol;sulfuric acid (CID 71362926) is cyclohexylmethanol;sulfuric acid.
What is the SMILES notation for cyclohexylmethanol;sulfuric acid?
The canonical SMILES for cyclohexylmethanol;sulfuric acid is O=S(=O)(O)O.OCC1CCCCC1.OCC1CCCCC1.
What is the InChIKey of cyclohexylmethanol;sulfuric acid?
The InChIKey is DNJORSZQDNDXFO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H14O.H2O4S/c2*8-6-7-4-2-1-3-5-7;1-5(2,3)4/h2*7-8H,1-6H2;(H2,1,2,3,4).
What are the key properties of cyclohexylmethanol;sulfuric acid?
cyclohexylmethanol;sulfuric acid has a molecular weight of 326.46 g/mol, XLogP of 2.47, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexylmethanol;sulfuric acid is sourced from PubChem (CID 71362926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).