About hexane-1,1-diol;[4-(hydroxymethyl)cyclohexyl]methanol
hexane-1,1-diol;[4-(hydroxymethyl)cyclohexyl]methanol (PubChem CID 18471210) has the molecular formula C14H30O4
and a molecular weight of 262.39 g/mol. Its IUPAC name is hexane-1,1-diol;[4-(hydroxymethyl)cyclohexyl]methanol.
Molecular Properties
| Compound Name | hexane-1,1-diol;[4-(hydroxymethyl)cyclohexyl]methanol |
| PubChem CID | 18471210 |
| Molecular Formula | C14H30O4 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.21 |
| IUPAC Name | hexane-1,1-diol;[4-(hydroxymethyl)cyclohexyl]methanol |
| SMILES | CCCCCC(O)O.OCC1CCC(CO)CC1 |
| InChI | InChI=1S/C8H16O2.C6H14O2/c9-5-7-1-2-8(6-10)4-3-7;1-2-3-4-5-6(7)8/h7-10H,1-6H2;6-8H,2-5H2,1H3 |
| InChIKey | APOHLWFMIHHCFA-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze hexane-1,1-diol;[4-(hydroxymethyl)cyclohexyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexane-1,1-diol;[4-(hydroxymethyl)cyclohexyl]methanol?
The IUPAC name of hexane-1,1-diol;[4-(hydroxymethyl)cyclohexyl]methanol (CID 18471210) is hexane-1,1-diol;[4-(hydroxymethyl)cyclohexyl]methanol.
What is the SMILES notation for hexane-1,1-diol;[4-(hydroxymethyl)cyclohexyl]methanol?
The canonical SMILES for hexane-1,1-diol;[4-(hydroxymethyl)cyclohexyl]methanol is CCCCCC(O)O.OCC1CCC(CO)CC1.
What is the InChIKey of hexane-1,1-diol;[4-(hydroxymethyl)cyclohexyl]methanol?
The InChIKey is APOHLWFMIHHCFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2.C6H14O2/c9-5-7-1-2-8(6-10)4-3-7;1-2-3-4-5-6(7)8/h7-10H,1-6H2;6-8H,2-5H2,1H3.
What are the key properties of hexane-1,1-diol;[4-(hydroxymethyl)cyclohexyl]methanol?
hexane-1,1-diol;[4-(hydroxymethyl)cyclohexyl]methanol has a molecular weight of 262.39 g/mol, XLogP of 1.65, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hexane-1,1-diol;[4-(hydroxymethyl)cyclohexyl]methanol is sourced from PubChem (CID 18471210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).