About methane;propan-1-ol;propan-2-ol
methane;propan-1-ol;propan-2-ol (PubChem CID 159586175) has the molecular formula C10H32O2
and a molecular weight of 184.36 g/mol. Its IUPAC name is methane;propan-1-ol;propan-2-ol.
Molecular Properties
| Compound Name | methane;propan-1-ol;propan-2-ol |
| PubChem CID | 159586175 |
| Molecular Formula | C10H32O2 |
| Molecular Weight | 184.36 g/mol |
| Exact Mass | 184.24 |
| IUPAC Name | methane;propan-1-ol;propan-2-ol |
| SMILES | C.C.C.C.CC(C)O.CCCO |
| InChI | InChI=1S/2C3H8O.4CH4/c1-3(2)4;1-2-3-4;;;;/h3-4H,1-2H3;4H,2-3H2,1H3;4*1H4 |
| InChIKey | MJQKIMOSBYRVFG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methane;propan-1-ol;propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;propan-1-ol;propan-2-ol?
The IUPAC name of methane;propan-1-ol;propan-2-ol (CID 159586175) is methane;propan-1-ol;propan-2-ol.
What is the SMILES notation for methane;propan-1-ol;propan-2-ol?
The canonical SMILES for methane;propan-1-ol;propan-2-ol is C.C.C.C.CC(C)O.CCCO.
What is the InChIKey of methane;propan-1-ol;propan-2-ol?
The InChIKey is MJQKIMOSBYRVFG-UHFFFAOYSA-N. The full InChI is InChI=1S/2C3H8O.4CH4/c1-3(2)4;1-2-3-4;;;;/h3-4H,1-2H3;4H,2-3H2,1H3;4*1H4.
What are the key properties of methane;propan-1-ol;propan-2-ol?
methane;propan-1-ol;propan-2-ol has a molecular weight of 184.36 g/mol, XLogP of 3.32, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;propan-1-ol;propan-2-ol is sourced from PubChem (CID 159586175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).