C9H21NO4 — CID 123530064
6-(propylamino)hexane-1,2,4,5-tetrol (PubChem CID 123530064) has the molecular formula C9H21NO4 and a molecular weight of 207.27 g/mol. Its IUPAC name is 6-(propylamino)hexane-1,2,4,5-tetrol.
| Compound Name | 6-(propylamino)hexane-1,2,4,5-tetrol |
|---|---|
| PubChem CID | 123530064 |
| Molecular Formula | C9H21NO4 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.15 |
| IUPAC Name | 6-(propylamino)hexane-1,2,4,5-tetrol |
| SMILES | CCCNCC(O)C(O)CC(O)CO |
| InChI | InChI=1S/C9H21NO4/c1-2-3-10-5-9(14)8(13)4-7(12)6-11/h7-14H,2-6H2,1H3 |
| InChIKey | ACLRPWFGHUTORP-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|