C9H19NO5 — CID 54195280
(2R,4R,5S)-2,4,5,6-tetrahydroxy-1-(propylamino)hexan-3-one (PubChem CID 54195280) has the molecular formula C9H19NO5 and a molecular weight of 221.25 g/mol. Its IUPAC name is (2R,4R,5S)-2,4,5,6-tetrahydroxy-1-(propylamino)hexan-3-one.
| Compound Name | (2R,4R,5S)-2,4,5,6-tetrahydroxy-1-(propylamino)hexan-3-one |
|---|---|
| PubChem CID | 54195280 |
| Molecular Formula | C9H19NO5 |
| Molecular Weight | 221.25 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | (2R,4R,5S)-2,4,5,6-tetrahydroxy-1-(propylamino)hexan-3-one |
| SMILES | CCCNC[C@@H](O)C(=O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C9H19NO5/c1-2-3-10-4-6(12)8(14)9(15)7(13)5-11/h6-7,9-13,15H,2-5H2,1H3/t6-,7+,9-/m1/s1 |
| InChIKey | PLJAOFQVLFXJTF-BKPPORCPSA-N |
| XLogP | -2.37 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.25 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|