C15H19I3N2O8 — CID 18362190
N-[5-(2,3-dihydroxypropanoylamino)-2-(2,3-dihydroxypropyl)-3,4,6-triiodophenyl]-2,3-dihydroxypropanamide (PubChem CID 18362190) has the molecular formula C15H19I3N2O8 and a molecular weight of 736.03 g/mol. Its IUPAC name is N-[5-(2,3-dihydroxypropanoylamino)-2-(2,3-dihydroxypropyl)-3,4,6-triiodophenyl]-2,3-dihydroxypropanamide.
| Compound Name | N-[5-(2,3-dihydroxypropanoylamino)-2-(2,3-dihydroxypropyl)-3,4,6-triiodophenyl]-2,3-dihydroxypropanamide |
|---|---|
| PubChem CID | 18362190 |
| Molecular Formula | C15H19I3N2O8 |
| Molecular Weight | 736.03 g/mol |
| Exact Mass | 735.83 |
| IUPAC Name | N-[5-(2,3-dihydroxypropanoylamino)-2-(2,3-dihydroxypropyl)-3,4,6-triiodophenyl]-2,3-dihydroxypropanamide |
| SMILES | O=C(Nc1c(I)c(I)c(CC(O)CO)c(NC(=O)C(O)CO)c1I)C(O)CO |
| InChI | InChI=1S/C15H19I3N2O8/c16-9-6(1-5(24)2-21)12(19-14(27)7(25)3-22)11(18)13(10(9)17)20-15(28)8(26)4-23/h5,7-8,21-26H,1-4H2,(H,19,27)(H,20,28) |
| InChIKey | XDYDSKFLSKHVGT-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 179.58 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.03 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|