C13H21NO3S — CID 62529808
2-[(3-methoxyphenyl)methyl]-4-methylsulfonylbutan-1-amine (PubChem CID 62529808) has the molecular formula C13H21NO3S and a molecular weight of 271.38 g/mol. Its IUPAC name is 2-[(3-methoxyphenyl)methyl]-4-methylsulfonylbutan-1-amine.
| Compound Name | 2-[(3-methoxyphenyl)methyl]-4-methylsulfonylbutan-1-amine |
|---|---|
| PubChem CID | 62529808 |
| Molecular Formula | C13H21NO3S |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 2-[(3-methoxyphenyl)methyl]-4-methylsulfonylbutan-1-amine |
| SMILES | COc1cccc(CC(CN)CCS(C)(=O)=O)c1 |
| InChI | InChI=1S/C13H21NO3S/c1-17-13-5-3-4-11(9-13)8-12(10-14)6-7-18(2,15)16/h3-5,9,12H,6-8,10,14H2,1-2H3 |
| InChIKey | ZRVIQELQMFEZPX-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |