C16H27NO — CID 103729443
N-[2-(3-methoxyphenyl)ethyl]heptan-4-amine (PubChem CID 103729443) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is N-[2-(3-methoxyphenyl)ethyl]heptan-4-amine.
| Compound Name | N-[2-(3-methoxyphenyl)ethyl]heptan-4-amine |
|---|---|
| PubChem CID | 103729443 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | N-[2-(3-methoxyphenyl)ethyl]heptan-4-amine |
| SMILES | CCCC(CCC)NCCc1cccc(OC)c1 |
| InChI | InChI=1S/C16H27NO/c1-4-7-15(8-5-2)17-12-11-14-9-6-10-16(13-14)18-3/h6,9-10,13,15,17H,4-5,7-8,11-12H2,1-3H3 |
| InChIKey | FATWDEWBKHBKDO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |