C33H48N2O5 — CID 57235543
N-(2-cyclohexylethyl)-N'-[2-[3,4-dimethoxy-2-[2-(3-methoxyphenyl)ethyl]phenyl]ethyl]hexanediamide (PubChem CID 57235543) has the molecular formula C33H48N2O5 and a molecular weight of 552.76 g/mol. Its IUPAC name is N-(2-cyclohexylethyl)-N'-[2-[3,4-dimethoxy-2-[2-(3-methoxyphenyl)ethyl]phenyl]ethyl]hexanediamide.
| Compound Name | N-(2-cyclohexylethyl)-N'-[2-[3,4-dimethoxy-2-[2-(3-methoxyphenyl)ethyl]phenyl]ethyl]hexanediamide |
|---|---|
| PubChem CID | 57235543 |
| Molecular Formula | C33H48N2O5 |
| Molecular Weight | 552.76 g/mol |
| Exact Mass | 552.36 |
| IUPAC Name | N-(2-cyclohexylethyl)-N'-[2-[3,4-dimethoxy-2-[2-(3-methoxyphenyl)ethyl]phenyl]ethyl]hexanediamide |
| SMILES | COc1cccc(CCc2c(CCNC(=O)CCCCC(=O)NCCC3CCCCC3)ccc(OC)c2OC)c1 |
| InChI | InChI=1S/C33H48N2O5/c1-38-28-13-9-12-26(24-28)16-18-29-27(17-19-30(39-2)33(29)40-3)21-23-35-32(37)15-8-7-14-31(36)34-22-20-25-10-5-4-6-11-25/h9,12-13,17,19,24-25H,4-8,10-11,14-16,18,20-23H2,1-3H3,(H,34,36)(H,35,37) |
| InChIKey | VJKNOHCUAWEFQS-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.76 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|