C30H36N2O4S — CID 19838103
N'-[2-(3,4-dimethoxy-2-phenylsulfanylphenyl)ethyl]-N-(2-phenylethyl)hexanediamide (PubChem CID 19838103) has the molecular formula C30H36N2O4S and a molecular weight of 520.70 g/mol. Its IUPAC name is N'-[2-(3,4-dimethoxy-2-phenylsulfanylphenyl)ethyl]-N-(2-phenylethyl)hexanediamide.
| Compound Name | N'-[2-(3,4-dimethoxy-2-phenylsulfanylphenyl)ethyl]-N-(2-phenylethyl)hexanediamide |
|---|---|
| PubChem CID | 19838103 |
| Molecular Formula | C30H36N2O4S |
| Molecular Weight | 520.70 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | N'-[2-(3,4-dimethoxy-2-phenylsulfanylphenyl)ethyl]-N-(2-phenylethyl)hexanediamide |
| SMILES | COc1ccc(CCNC(=O)CCCCC(=O)NCCc2ccccc2)c(Sc2ccccc2)c1OC |
| InChI | InChI=1S/C30H36N2O4S/c1-35-26-18-17-24(30(29(26)36-2)37-25-13-7-4-8-14-25)20-22-32-28(34)16-10-9-15-27(33)31-21-19-23-11-5-3-6-12-23/h3-8,11-14,17-18H,9-10,15-16,19-22H2,1-2H3,(H,31,33)(H,32,34) |
| InChIKey | GMFQDXPMWHNOJV-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.70 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|