C26H36N2O4 — CID 19838169
N'-[2-(3,4-dimethoxyphenyl)-2-methylpropyl]-N-(2-phenylethyl)hexanediamide (PubChem CID 19838169) has the molecular formula C26H36N2O4 and a molecular weight of 440.58 g/mol. Its IUPAC name is N'-[2-(3,4-dimethoxyphenyl)-2-methylpropyl]-N-(2-phenylethyl)hexanediamide.
| Compound Name | N'-[2-(3,4-dimethoxyphenyl)-2-methylpropyl]-N-(2-phenylethyl)hexanediamide |
|---|---|
| PubChem CID | 19838169 |
| Molecular Formula | C26H36N2O4 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | N'-[2-(3,4-dimethoxyphenyl)-2-methylpropyl]-N-(2-phenylethyl)hexanediamide |
| SMILES | COc1ccc(C(C)(C)CNC(=O)CCCCC(=O)NCCc2ccccc2)cc1OC |
| InChI | InChI=1S/C26H36N2O4/c1-26(2,21-14-15-22(31-3)23(18-21)32-4)19-28-25(30)13-9-8-12-24(29)27-17-16-20-10-6-5-7-11-20/h5-7,10-11,14-15,18H,8-9,12-13,16-17,19H2,1-4H3,(H,27,29)(H,28,30) |
| InChIKey | YIYLHTQOSHEDOU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|