C14H21FN2O2 — CID 115158297
N-[2-(3-fluoro-4-methoxyphenyl)ethyl]-2-(propan-2-ylamino)acetamide (PubChem CID 115158297) has the molecular formula C14H21FN2O2 and a molecular weight of 268.33 g/mol. Its IUPAC name is N-[2-(3-fluoro-4-methoxyphenyl)ethyl]-2-(propan-2-ylamino)acetamide.
| Compound Name | N-[2-(3-fluoro-4-methoxyphenyl)ethyl]-2-(propan-2-ylamino)acetamide |
|---|---|
| PubChem CID | 115158297 |
| Molecular Formula | C14H21FN2O2 |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | N-[2-(3-fluoro-4-methoxyphenyl)ethyl]-2-(propan-2-ylamino)acetamide |
| SMILES | COc1ccc(CCNC(=O)CNC(C)C)cc1F |
| InChI | InChI=1S/C14H21FN2O2/c1-10(2)17-9-14(18)16-7-6-11-4-5-13(19-3)12(15)8-11/h4-5,8,10,17H,6-7,9H2,1-3H3,(H,16,18) |
| InChIKey | JPBOEGORBIGASR-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |