C22H16Cl3FN2S — CID 6163457
[4-[(E)-2-(2-chloro-6-fluorophenyl)ethenyl]phenyl]methyl N'-(3,5-dichlorophenyl)carbamimidothioate (PubChem CID 6163457) has the molecular formula C22H16Cl3FN2S and a molecular weight of 465.81 g/mol. Its IUPAC name is [4-[(E)-2-(2-chloro-6-fluorophenyl)ethenyl]phenyl]methyl N'-(3,5-dichlorophenyl)carbamimidothioate.
| Compound Name | [4-[(E)-2-(2-chloro-6-fluorophenyl)ethenyl]phenyl]methyl N'-(3,5-dichlorophenyl)carbamimidothioate |
|---|---|
| PubChem CID | 6163457 |
| Molecular Formula | C22H16Cl3FN2S |
| Molecular Weight | 465.81 g/mol |
| Exact Mass | 464.01 |
| IUPAC Name | [4-[(E)-2-(2-chloro-6-fluorophenyl)ethenyl]phenyl]methyl N'-(3,5-dichlorophenyl)carbamimidothioate |
| SMILES | N/C(=N\c1cc(Cl)cc(Cl)c1)SCc1ccc(/C=C/c2c(F)cccc2Cl)cc1 |
| InChI | InChI=1S/C22H16Cl3FN2S/c23-16-10-17(24)12-18(11-16)28-22(27)29-13-15-6-4-14(5-7-15)8-9-19-20(25)2-1-3-21(19)26/h1-12H,13H2,(H2,27,28)/b9-8+ |
| InChIKey | HELLJMCHMOVNDC-CMDGGOBGSA-N |
| XLogP | 7.84 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.81 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|