C16H14ClF — CID 144958510
1-chloro-2-[(E)-2-(3,4-dimethylphenyl)ethenyl]-3-fluorobenzene (PubChem CID 144958510) has the molecular formula C16H14ClF and a molecular weight of 260.74 g/mol. Its IUPAC name is 1-chloro-2-[(E)-2-(3,4-dimethylphenyl)ethenyl]-3-fluorobenzene.
| Compound Name | 1-chloro-2-[(E)-2-(3,4-dimethylphenyl)ethenyl]-3-fluorobenzene |
|---|---|
| PubChem CID | 144958510 |
| Molecular Formula | C16H14ClF |
| Molecular Weight | 260.74 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 1-chloro-2-[(E)-2-(3,4-dimethylphenyl)ethenyl]-3-fluorobenzene |
| SMILES | Cc1ccc(/C=C/c2c(F)cccc2Cl)cc1C |
| InChI | InChI=1S/C16H14ClF/c1-11-6-7-13(10-12(11)2)8-9-14-15(17)4-3-5-16(14)18/h3-10H,1-2H3/b9-8+ |
| InChIKey | OCKBOGCQIYSQLC-CMDGGOBGSA-N |
| XLogP | 5.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.74 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|