C12H16Cl2N2S — CID 8776217
(2,6-dichlorophenyl)methyl N'-butylcarbamimidothioate (PubChem CID 8776217) has the molecular formula C12H16Cl2N2S and a molecular weight of 291.25 g/mol. Its IUPAC name is (2,6-dichlorophenyl)methyl N'-butylcarbamimidothioate.
| Compound Name | (2,6-dichlorophenyl)methyl N'-butylcarbamimidothioate |
|---|---|
| PubChem CID | 8776217 |
| Molecular Formula | C12H16Cl2N2S |
| Molecular Weight | 291.25 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | (2,6-dichlorophenyl)methyl N'-butylcarbamimidothioate |
| SMILES | CCCC/N=C(\N)SCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H16Cl2N2S/c1-2-3-7-16-12(15)17-8-9-10(13)5-4-6-11(9)14/h4-6H,2-3,7-8H2,1H3,(H2,15,16) |
| InChIKey | NTLJIJWOQPGLMN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.25 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|