C12H18Cl2IN3 — CID 111078654
1-[2-(2,6-dichlorophenyl)ethyl]-2-propylguanidine;hydroiodide (PubChem CID 111078654) has the molecular formula C12H18Cl2IN3 and a molecular weight of 402.11 g/mol. Its IUPAC name is 1-[2-(2,6-dichlorophenyl)ethyl]-2-propylguanidine;hydroiodide.
| Compound Name | 1-[2-(2,6-dichlorophenyl)ethyl]-2-propylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111078654 |
| Molecular Formula | C12H18Cl2IN3 |
| Molecular Weight | 402.11 g/mol |
| Exact Mass | 400.99 |
| IUPAC Name | 1-[2-(2,6-dichlorophenyl)ethyl]-2-propylguanidine;hydroiodide |
| SMILES | CCC/N=C(\N)NCCc1c(Cl)cccc1Cl.I |
| InChI | InChI=1S/C12H17Cl2N3.HI/c1-2-7-16-12(15)17-8-6-9-10(13)4-3-5-11(9)14;/h3-5H,2,6-8H2,1H3,(H3,15,16,17);1H |
| InChIKey | DORFRSDQUMGTPF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.11 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|