C15H23IN4 — CID 111100810
1-[2-(4-methyl-1H-indol-3-yl)ethyl]-2-propylguanidine;hydroiodide (PubChem CID 111100810) has the molecular formula C15H23IN4 and a molecular weight of 386.28 g/mol. Its IUPAC name is 1-[2-(4-methyl-1H-indol-3-yl)ethyl]-2-propylguanidine;hydroiodide.
| Compound Name | 1-[2-(4-methyl-1H-indol-3-yl)ethyl]-2-propylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111100810 |
| Molecular Formula | C15H23IN4 |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 1-[2-(4-methyl-1H-indol-3-yl)ethyl]-2-propylguanidine;hydroiodide |
| SMILES | CCC/N=C(\N)NCCc1c[nH]c2cccc(C)c12.I |
| InChI | InChI=1S/C15H22N4.HI/c1-3-8-17-15(16)18-9-7-12-10-19-13-6-4-5-11(2)14(12)13;/h4-6,10,19H,3,7-9H2,1-2H3,(H3,16,17,18);1H |
| InChIKey | MGKRNPQIYJCCSL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 66.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|