C15H20N4 — CID 111100831
1-cyclopropyl-2-[2-(4-methyl-1H-indol-3-yl)ethyl]guanidine (PubChem CID 111100831) has the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. Its IUPAC name is 1-cyclopropyl-2-[2-(4-methyl-1H-indol-3-yl)ethyl]guanidine.
| Compound Name | 1-cyclopropyl-2-[2-(4-methyl-1H-indol-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111100831 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 1-cyclopropyl-2-[2-(4-methyl-1H-indol-3-yl)ethyl]guanidine |
| SMILES | Cc1cccc2[nH]cc(CC/N=C(\N)NC3CC3)c12 |
| InChI | InChI=1S/C15H20N4/c1-10-3-2-4-13-14(10)11(9-18-13)7-8-17-15(16)19-12-5-6-12/h2-4,9,12,18H,5-8H2,1H3,(H3,16,17,19) |
| InChIKey | LIXOCBHVWUUWIW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 66.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|