C20H30N4O — CID 111190424
1-ethyl-3-(4-hydroxycyclohexyl)-2-[2-(4-methyl-1H-indol-3-yl)ethyl]guanidine (PubChem CID 111190424) has the molecular formula C20H30N4O and a molecular weight of 342.49 g/mol. Its IUPAC name is 1-ethyl-3-(4-hydroxycyclohexyl)-2-[2-(4-methyl-1H-indol-3-yl)ethyl]guanidine.
| Compound Name | 1-ethyl-3-(4-hydroxycyclohexyl)-2-[2-(4-methyl-1H-indol-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111190424 |
| Molecular Formula | C20H30N4O |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | 1-ethyl-3-(4-hydroxycyclohexyl)-2-[2-(4-methyl-1H-indol-3-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CCc1c[nH]c2cccc(C)c12)NC1CCC(O)CC1 |
| InChI | InChI=1S/C20H30N4O/c1-3-21-20(24-16-7-9-17(25)10-8-16)22-12-11-15-13-23-18-6-4-5-14(2)19(15)18/h4-6,13,16-17,23,25H,3,7-12H2,1-2H3,(H2,21,22,24) |
| InChIKey | OAXAOYRILMLDKB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|