C12H14ClFN2S — CID 2805960
(2-chloro-6-fluorophenyl)methyl 3-(dimethylamino)prop-2-enimidothioate (PubChem CID 2805960) has the molecular formula C12H14ClFN2S and a molecular weight of 272.78 g/mol. Its IUPAC name is (2-chloro-6-fluorophenyl)methyl 3-(dimethylamino)prop-2-enimidothioate.
| Compound Name | (2-chloro-6-fluorophenyl)methyl 3-(dimethylamino)prop-2-enimidothioate |
|---|---|
| PubChem CID | 2805960 |
| Molecular Formula | C12H14ClFN2S |
| Molecular Weight | 272.78 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | (2-chloro-6-fluorophenyl)methyl 3-(dimethylamino)prop-2-enimidothioate |
| SMILES | [H]/N=C(\C=CN(C)C)SCc1c(F)cccc1Cl |
| InChI | InChI=1S/C12H14ClFN2S/c1-16(2)7-6-12(15)17-8-9-10(13)4-3-5-11(9)14/h3-7,15H,8H2,1-2H3/b7-6?,15-12+ |
| InChIKey | GFSPGZXFKXAKKI-JTODYINNSA-N |
| XLogP | 3.76 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.78 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|