C12H13ClFN5S — CID 46246067
N'-[3-[(2-chloro-6-fluorophenyl)methylsulfanyl]-1H-1,2,4-triazol-5-yl]-N,N-dimethylmethanimidamide (PubChem CID 46246067) has the molecular formula C12H13ClFN5S and a molecular weight of 313.79 g/mol. Its IUPAC name is N'-[3-[(2-chloro-6-fluorophenyl)methylsulfanyl]-1H-1,2,4-triazol-5-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[3-[(2-chloro-6-fluorophenyl)methylsulfanyl]-1H-1,2,4-triazol-5-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 46246067 |
| Molecular Formula | C12H13ClFN5S |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | N'-[3-[(2-chloro-6-fluorophenyl)methylsulfanyl]-1H-1,2,4-triazol-5-yl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/c1nc(SCc2c(F)cccc2Cl)n[nH]1 |
| InChI | InChI=1S/C12H13ClFN5S/c1-19(2)7-15-11-16-12(18-17-11)20-6-8-9(13)4-3-5-10(8)14/h3-5,7H,6H2,1-2H3,(H,16,17,18)/b15-7+ |
| InChIKey | JEWQEGQPPDHCHU-VIZOYTHASA-N |
| XLogP | 3.11 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|