C20H18Cl2F2N4S2 — CID 36688554
(1R,5R)-3,7-bis[(2-chloro-6-fluorophenyl)methylsulfanyl]-1,5-dimethyl-1,5-dihydro-[1,2,4]triazolo[1,2-a][1,2,4]triazole (PubChem CID 36688554) has the molecular formula C20H18Cl2F2N4S2 and a molecular weight of 487.43 g/mol. Its IUPAC name is (1R,5R)-3,7-bis[(2-chloro-6-fluorophenyl)methylsulfanyl]-1,5-dimethyl-1,5-dihydro-[1,2,4]triazolo[1,2-a][1,2,4]triazole.
| Compound Name | (1R,5R)-3,7-bis[(2-chloro-6-fluorophenyl)methylsulfanyl]-1,5-dimethyl-1,5-dihydro-[1,2,4]triazolo[1,2-a][1,2,4]triazole |
|---|---|
| PubChem CID | 36688554 |
| Molecular Formula | C20H18Cl2F2N4S2 |
| Molecular Weight | 487.43 g/mol |
| Exact Mass | 486.03 |
| IUPAC Name | (1R,5R)-3,7-bis[(2-chloro-6-fluorophenyl)methylsulfanyl]-1,5-dimethyl-1,5-dihydro-[1,2,4]triazolo[1,2-a][1,2,4]triazole |
| SMILES | C[C@@H]1N=C(SCc2c(F)cccc2Cl)N2[C@H](C)N=C(SCc3c(F)cccc3Cl)N12 |
| InChI | InChI=1S/C20H18Cl2F2N4S2/c1-11-25-19(29-9-13-15(21)5-3-7-17(13)23)28-12(2)26-20(27(11)28)30-10-14-16(22)6-4-8-18(14)24/h3-8,11-12H,9-10H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | CBQTZFKNNLDPPN-VXGBXAGGSA-N |
| XLogP | 6.39 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.43 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |