C13H9ClF4N2OS — CID 1486653
2-[(2-chloro-6-fluorophenyl)methylsulfanyl]-3-methyl-6-(trifluoromethyl)pyrimidin-4-one (PubChem CID 1486653) has the molecular formula C13H9ClF4N2OS and a molecular weight of 352.74 g/mol. Its IUPAC name is 2-[(2-chloro-6-fluorophenyl)methylsulfanyl]-3-methyl-6-(trifluoromethyl)pyrimidin-4-one.
| Compound Name | 2-[(2-chloro-6-fluorophenyl)methylsulfanyl]-3-methyl-6-(trifluoromethyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 1486653 |
| Molecular Formula | C13H9ClF4N2OS |
| Molecular Weight | 352.74 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | 2-[(2-chloro-6-fluorophenyl)methylsulfanyl]-3-methyl-6-(trifluoromethyl)pyrimidin-4-one |
| SMILES | Cn1c(SCc2c(F)cccc2Cl)nc(C(F)(F)F)cc1=O |
| InChI | InChI=1S/C13H9ClF4N2OS/c1-20-11(21)5-10(13(16,17)18)19-12(20)22-6-7-8(14)3-2-4-9(7)15/h2-5H,6H2,1H3 |
| InChIKey | MNCSVLCBUUWPQG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.74 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |