C15H11ClF4N2OS — CID 1488416
2-[(2-chloro-6-fluorophenyl)methylsulfanyl]-3-prop-2-enyl-6-(trifluoromethyl)pyrimidin-4-one (PubChem CID 1488416) has the molecular formula C15H11ClF4N2OS and a molecular weight of 378.78 g/mol. Its IUPAC name is 2-[(2-chloro-6-fluorophenyl)methylsulfanyl]-3-prop-2-enyl-6-(trifluoromethyl)pyrimidin-4-one.
| Compound Name | 2-[(2-chloro-6-fluorophenyl)methylsulfanyl]-3-prop-2-enyl-6-(trifluoromethyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 1488416 |
| Molecular Formula | C15H11ClF4N2OS |
| Molecular Weight | 378.78 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | 2-[(2-chloro-6-fluorophenyl)methylsulfanyl]-3-prop-2-enyl-6-(trifluoromethyl)pyrimidin-4-one |
| SMILES | C=CCn1c(SCc2c(F)cccc2Cl)nc(C(F)(F)F)cc1=O |
| InChI | InChI=1S/C15H11ClF4N2OS/c1-2-6-22-13(23)7-12(15(18,19)20)21-14(22)24-8-9-10(16)4-3-5-11(9)17/h2-5,7H,1,6,8H2 |
| InChIKey | FGBZNYKMYNDVQU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.78 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|