C12H13F3N2O3S — CID 1488408
ethyl 2-[6-oxo-1-prop-2-enyl-4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetate (PubChem CID 1488408) has the molecular formula C12H13F3N2O3S and a molecular weight of 322.31 g/mol. Its IUPAC name is ethyl 2-[6-oxo-1-prop-2-enyl-4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetate.
| Compound Name | ethyl 2-[6-oxo-1-prop-2-enyl-4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 1488408 |
| Molecular Formula | C12H13F3N2O3S |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | ethyl 2-[6-oxo-1-prop-2-enyl-4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetate |
| SMILES | C=CCn1c(SCC(=O)OCC)nc(C(F)(F)F)cc1=O |
| InChI | InChI=1S/C12H13F3N2O3S/c1-3-5-17-9(18)6-8(12(13,14)15)16-11(17)21-7-10(19)20-4-2/h3,6H,1,4-5,7H2,2H3 |
| InChIKey | FBTPOZZRYNXHPJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|