C12H11F3N2O2S — CID 56691280
ethyl 2-[[3-cyano-4-methyl-6-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetate (PubChem CID 56691280) has the molecular formula C12H11F3N2O2S and a molecular weight of 304.29 g/mol. Its IUPAC name is ethyl 2-[[3-cyano-4-methyl-6-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[3-cyano-4-methyl-6-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetate |
|---|---|
| PubChem CID | 56691280 |
| Molecular Formula | C12H11F3N2O2S |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | ethyl 2-[[3-cyano-4-methyl-6-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1nc(C(F)(F)F)cc(C)c1C#N |
| InChI | InChI=1S/C12H11F3N2O2S/c1-3-19-10(18)6-20-11-8(5-16)7(2)4-9(17-11)12(13,14)15/h4H,3,6H2,1-2H3 |
| InChIKey | WZMZBXVFPNXXKZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |