C11H9F3N2O2S — CID 53269873
2-[[3-cyano-4-methyl-6-(trifluoromethyl)-2-pyridinyl]sulfanyl]propanoic acid (PubChem CID 53269873) has the molecular formula C11H9F3N2O2S and a molecular weight of 290.27 g/mol. Its IUPAC name is 2-[[3-cyano-4-methyl-6-(trifluoromethyl)-2-pyridinyl]sulfanyl]propanoic acid.
| Compound Name | 2-[[3-cyano-4-methyl-6-(trifluoromethyl)-2-pyridinyl]sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 53269873 |
| Molecular Formula | C11H9F3N2O2S |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 2-[[3-cyano-4-methyl-6-(trifluoromethyl)-2-pyridinyl]sulfanyl]propanoic acid |
| SMILES | Cc1cc(C(F)(F)F)nc(SC(C)C(=O)O)c1C#N |
| InChI | InChI=1S/C11H9F3N2O2S/c1-5-3-8(11(12,13)14)16-9(7(5)4-15)19-6(2)10(17)18/h3,6H,1-2H3,(H,17,18) |
| InChIKey | XDFVPYLJJPWKHE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 73.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |