C12H13F3N4O — CID 10803099
N'-[3-cyano-4-methyl-6-(trifluoromethyl)-2-pyridinyl]-2-methylpropanehydrazide (PubChem CID 10803099) has the molecular formula C12H13F3N4O and a molecular weight of 286.26 g/mol. Its IUPAC name is N'-[3-cyano-4-methyl-6-(trifluoromethyl)-2-pyridinyl]-2-methylpropanehydrazide.
| Compound Name | N'-[3-cyano-4-methyl-6-(trifluoromethyl)-2-pyridinyl]-2-methylpropanehydrazide |
|---|---|
| PubChem CID | 10803099 |
| Molecular Formula | C12H13F3N4O |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | N'-[3-cyano-4-methyl-6-(trifluoromethyl)-2-pyridinyl]-2-methylpropanehydrazide |
| SMILES | Cc1cc(C(F)(F)F)nc(NNC(=O)C(C)C)c1C#N |
| InChI | InChI=1S/C12H13F3N4O/c1-6(2)11(20)19-18-10-8(5-16)7(3)4-9(17-10)12(13,14)15/h4,6H,1-3H3,(H,17,18)(H,19,20) |
| InChIKey | PMWDWPVBBGNXIC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|