C10H8F3N3O2 — CID 1229880
2-[[3-cyano-4-methyl-6-(trifluoromethyl)-2-pyridinyl]oxy]acetamide (PubChem CID 1229880) has the molecular formula C10H8F3N3O2 and a molecular weight of 259.19 g/mol. Its IUPAC name is 2-[[3-cyano-4-methyl-6-(trifluoromethyl)-2-pyridinyl]oxy]acetamide.
| Compound Name | 2-[[3-cyano-4-methyl-6-(trifluoromethyl)-2-pyridinyl]oxy]acetamide |
|---|---|
| PubChem CID | 1229880 |
| Molecular Formula | C10H8F3N3O2 |
| Molecular Weight | 259.19 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 2-[[3-cyano-4-methyl-6-(trifluoromethyl)-2-pyridinyl]oxy]acetamide |
| SMILES | Cc1cc(C(F)(F)F)nc(OCC(N)=O)c1C#N |
| InChI | InChI=1S/C10H8F3N3O2/c1-5-2-7(10(11,12)13)16-9(6(5)3-14)18-4-8(15)17/h2H,4H2,1H3,(H2,15,17) |
| InChIKey | SQQGXPWGINFIIE-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.19 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |