C15H11Cl2F3N2OS — CID 1488409
2-[(3,4-dichlorophenyl)methylsulfanyl]-3-prop-2-enyl-6-(trifluoromethyl)pyrimidin-4-one (PubChem CID 1488409) has the molecular formula C15H11Cl2F3N2OS and a molecular weight of 395.23 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methylsulfanyl]-3-prop-2-enyl-6-(trifluoromethyl)pyrimidin-4-one.
| Compound Name | 2-[(3,4-dichlorophenyl)methylsulfanyl]-3-prop-2-enyl-6-(trifluoromethyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 1488409 |
| Molecular Formula | C15H11Cl2F3N2OS |
| Molecular Weight | 395.23 g/mol |
| Exact Mass | 393.99 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methylsulfanyl]-3-prop-2-enyl-6-(trifluoromethyl)pyrimidin-4-one |
| SMILES | C=CCn1c(SCc2ccc(Cl)c(Cl)c2)nc(C(F)(F)F)cc1=O |
| InChI | InChI=1S/C15H11Cl2F3N2OS/c1-2-5-22-13(23)7-12(15(18,19)20)21-14(22)24-8-9-3-4-10(16)11(17)6-9/h2-4,6-7H,1,5,8H2 |
| InChIKey | HXNRCAXOWUFXKT-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.23 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|