C19H17Cl2N3O2S2 — CID 23406558
3-(benzenesulfonylmethyl)-5-[(3,4-dichlorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole (PubChem CID 23406558) has the molecular formula C19H17Cl2N3O2S2 and a molecular weight of 454.40 g/mol. Its IUPAC name is 3-(benzenesulfonylmethyl)-5-[(3,4-dichlorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole.
| Compound Name | 3-(benzenesulfonylmethyl)-5-[(3,4-dichlorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 23406558 |
| Molecular Formula | C19H17Cl2N3O2S2 |
| Molecular Weight | 454.40 g/mol |
| Exact Mass | 453.01 |
| IUPAC Name | 3-(benzenesulfonylmethyl)-5-[(3,4-dichlorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole |
| SMILES | C=CCn1c(CS(=O)(=O)c2ccccc2)nnc1SCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H17Cl2N3O2S2/c1-2-10-24-18(13-28(25,26)15-6-4-3-5-7-15)22-23-19(24)27-12-14-8-9-16(20)17(21)11-14/h2-9,11H,1,10,12-13H2 |
| InChIKey | ONKNVYNVAACABM-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.40 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|