C21H21N3O3S2 — CID 23406634
2-[[5-(benzenesulfonylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-1-(4-methylphenyl)ethanone (PubChem CID 23406634) has the molecular formula C21H21N3O3S2 and a molecular weight of 427.55 g/mol. Its IUPAC name is 2-[[5-(benzenesulfonylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-1-(4-methylphenyl)ethanone.
| Compound Name | 2-[[5-(benzenesulfonylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-1-(4-methylphenyl)ethanone |
|---|---|
| PubChem CID | 23406634 |
| Molecular Formula | C21H21N3O3S2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 2-[[5-(benzenesulfonylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-1-(4-methylphenyl)ethanone |
| SMILES | C=CCn1c(CS(=O)(=O)c2ccccc2)nnc1SCC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H21N3O3S2/c1-3-13-24-20(15-29(26,27)18-7-5-4-6-8-18)22-23-21(24)28-14-19(25)17-11-9-16(2)10-12-17/h3-12H,1,13-15H2,2H3 |
| InChIKey | MOEWTYPDQNKHBP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 81.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|