C21H21N3O4S2 — CID 23407712
2-[[5-[(4-methylphenyl)sulfonylmethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]benzoic acid (PubChem CID 23407712) has the molecular formula C21H21N3O4S2 and a molecular weight of 443.55 g/mol. Its IUPAC name is 2-[[5-[(4-methylphenyl)sulfonylmethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]benzoic acid.
| Compound Name | 2-[[5-[(4-methylphenyl)sulfonylmethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]benzoic acid |
|---|---|
| PubChem CID | 23407712 |
| Molecular Formula | C21H21N3O4S2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | 2-[[5-[(4-methylphenyl)sulfonylmethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]benzoic acid |
| SMILES | C=CCn1c(CS(=O)(=O)c2ccc(C)cc2)nnc1SCc1ccccc1C(=O)O |
| InChI | InChI=1S/C21H21N3O4S2/c1-3-12-24-19(14-30(27,28)17-10-8-15(2)9-11-17)22-23-21(24)29-13-16-6-4-5-7-18(16)20(25)26/h3-11H,1,12-14H2,2H3,(H,25,26) |
| InChIKey | DZUMDHZDHRUHJE-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|