C23H24N4O5S2 — CID 23407780
3-[2-[[5-[(4-methylphenyl)sulfonylmethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanoylamino]benzoic acid (PubChem CID 23407780) has the molecular formula C23H24N4O5S2 and a molecular weight of 500.60 g/mol. Its IUPAC name is 3-[2-[[5-[(4-methylphenyl)sulfonylmethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanoylamino]benzoic acid.
| Compound Name | 3-[2-[[5-[(4-methylphenyl)sulfonylmethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 23407780 |
| Molecular Formula | C23H24N4O5S2 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | 3-[2-[[5-[(4-methylphenyl)sulfonylmethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanoylamino]benzoic acid |
| SMILES | C=CCn1c(CS(=O)(=O)c2ccc(C)cc2)nnc1SC(C)C(=O)Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C23H24N4O5S2/c1-4-12-27-20(14-34(31,32)19-10-8-15(2)9-11-19)25-26-23(27)33-16(3)21(28)24-18-7-5-6-17(13-18)22(29)30/h4-11,13,16H,1,12,14H2,2-3H3,(H,24,28)(H,29,30) |
| InChIKey | KYXKQGQJJCSKTA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 131.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|