C26H30N4O5S2 — CID 23407819
ethyl 3-[2-[[5-[(4-methylphenyl)sulfonylmethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]butanoylamino]benzoate (PubChem CID 23407819) has the molecular formula C26H30N4O5S2 and a molecular weight of 542.68 g/mol. Its IUPAC name is ethyl 3-[2-[[5-[(4-methylphenyl)sulfonylmethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]butanoylamino]benzoate.
| Compound Name | ethyl 3-[2-[[5-[(4-methylphenyl)sulfonylmethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]butanoylamino]benzoate |
|---|---|
| PubChem CID | 23407819 |
| Molecular Formula | C26H30N4O5S2 |
| Molecular Weight | 542.68 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | ethyl 3-[2-[[5-[(4-methylphenyl)sulfonylmethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]butanoylamino]benzoate |
| SMILES | C=CCn1c(CS(=O)(=O)c2ccc(C)cc2)nnc1SC(CC)C(=O)Nc1cccc(C(=O)OCC)c1 |
| InChI | InChI=1S/C26H30N4O5S2/c1-5-15-30-23(17-37(33,34)21-13-11-18(4)12-14-21)28-29-26(30)36-22(6-2)24(31)27-20-10-8-9-19(16-20)25(32)35-7-3/h5,8-14,16,22H,1,6-7,15,17H2,2-4H3,(H,27,31) |
| InChIKey | VQOFCPFCBJYCAN-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 120.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.68 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|