C22H23ClN4O3S2 — CID 23406783
2-[[5-(benzenesulfonylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-chlorophenyl)butanamide (PubChem CID 23406783) has the molecular formula C22H23ClN4O3S2 and a molecular weight of 491.04 g/mol. Its IUPAC name is 2-[[5-(benzenesulfonylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-chlorophenyl)butanamide.
| Compound Name | 2-[[5-(benzenesulfonylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-chlorophenyl)butanamide |
|---|---|
| PubChem CID | 23406783 |
| Molecular Formula | C22H23ClN4O3S2 |
| Molecular Weight | 491.04 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | 2-[[5-(benzenesulfonylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-chlorophenyl)butanamide |
| SMILES | C=CCn1c(CS(=O)(=O)c2ccccc2)nnc1SC(CC)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H23ClN4O3S2/c1-3-14-27-20(15-32(29,30)18-8-6-5-7-9-18)25-26-22(27)31-19(4-2)21(28)24-17-12-10-16(23)11-13-17/h3,5-13,19H,1,4,14-15H2,2H3,(H,24,28) |
| InChIKey | VNXMYMVAFARVMX-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.04 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|