C24H28N4O2S2 — CID 21012810
N-(4-ethoxyphenyl)-2-[[5-(phenylsulfanylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]butanamide (PubChem CID 21012810) has the molecular formula C24H28N4O2S2 and a molecular weight of 468.65 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2-[[5-(phenylsulfanylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]butanamide.
| Compound Name | N-(4-ethoxyphenyl)-2-[[5-(phenylsulfanylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]butanamide |
|---|---|
| PubChem CID | 21012810 |
| Molecular Formula | C24H28N4O2S2 |
| Molecular Weight | 468.65 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | N-(4-ethoxyphenyl)-2-[[5-(phenylsulfanylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]butanamide |
| SMILES | C=CCn1c(CSc2ccccc2)nnc1SC(CC)C(=O)Nc1ccc(OCC)cc1 |
| InChI | InChI=1S/C24H28N4O2S2/c1-4-16-28-22(17-31-20-10-8-7-9-11-20)26-27-24(28)32-21(5-2)23(29)25-18-12-14-19(15-13-18)30-6-3/h4,7-15,21H,1,5-6,16-17H2,2-3H3,(H,25,29) |
| InChIKey | URPDUVKEKOJSHK-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.65 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|