C25H24N4O2S2 — CID 21013069
N-(4-hydroxyphenyl)-2-[[4-phenyl-5-(phenylsulfanylmethyl)-1,2,4-triazol-3-yl]sulfanyl]butanamide (PubChem CID 21013069) has the molecular formula C25H24N4O2S2 and a molecular weight of 476.63 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)-2-[[4-phenyl-5-(phenylsulfanylmethyl)-1,2,4-triazol-3-yl]sulfanyl]butanamide.
| Compound Name | N-(4-hydroxyphenyl)-2-[[4-phenyl-5-(phenylsulfanylmethyl)-1,2,4-triazol-3-yl]sulfanyl]butanamide |
|---|---|
| PubChem CID | 21013069 |
| Molecular Formula | C25H24N4O2S2 |
| Molecular Weight | 476.63 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | N-(4-hydroxyphenyl)-2-[[4-phenyl-5-(phenylsulfanylmethyl)-1,2,4-triazol-3-yl]sulfanyl]butanamide |
| SMILES | CCC(Sc1nnc(CSc2ccccc2)n1-c1ccccc1)C(=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C25H24N4O2S2/c1-2-22(24(31)26-18-13-15-20(30)16-14-18)33-25-28-27-23(17-32-21-11-7-4-8-12-21)29(25)19-9-5-3-6-10-19/h3-16,22,30H,2,17H2,1H3,(H,26,31) |
| InChIKey | GAKOCXHZJKNWNW-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.63 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|