C15H19N3O2S2 — CID 23407582
3-ethylsulfanyl-5-[(4-methylphenyl)sulfonylmethyl]-4-prop-2-enyl-1,2,4-triazole (PubChem CID 23407582) has the molecular formula C15H19N3O2S2 and a molecular weight of 337.47 g/mol. Its IUPAC name is 3-ethylsulfanyl-5-[(4-methylphenyl)sulfonylmethyl]-4-prop-2-enyl-1,2,4-triazole.
| Compound Name | 3-ethylsulfanyl-5-[(4-methylphenyl)sulfonylmethyl]-4-prop-2-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 23407582 |
| Molecular Formula | C15H19N3O2S2 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 3-ethylsulfanyl-5-[(4-methylphenyl)sulfonylmethyl]-4-prop-2-enyl-1,2,4-triazole |
| SMILES | C=CCn1c(CS(=O)(=O)c2ccc(C)cc2)nnc1SCC |
| InChI | InChI=1S/C15H19N3O2S2/c1-4-10-18-14(16-17-15(18)21-5-2)11-22(19,20)13-8-6-12(3)7-9-13/h4,6-9H,1,5,10-11H2,2-3H3 |
| InChIKey | FJXYHRZTDQQFTD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|