C27H26N4O3S2 — CID 23407691
2-[[5-[(4-methylphenyl)sulfonylmethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N,N-diphenylacetamide (PubChem CID 23407691) has the molecular formula C27H26N4O3S2 and a molecular weight of 518.66 g/mol. Its IUPAC name is 2-[[5-[(4-methylphenyl)sulfonylmethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N,N-diphenylacetamide.
| Compound Name | 2-[[5-[(4-methylphenyl)sulfonylmethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N,N-diphenylacetamide |
|---|---|
| PubChem CID | 23407691 |
| Molecular Formula | C27H26N4O3S2 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | 2-[[5-[(4-methylphenyl)sulfonylmethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N,N-diphenylacetamide |
| SMILES | C=CCn1c(CS(=O)(=O)c2ccc(C)cc2)nnc1SCC(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H26N4O3S2/c1-3-18-30-25(20-36(33,34)24-16-14-21(2)15-17-24)28-29-27(30)35-19-26(32)31(22-10-6-4-7-11-22)23-12-8-5-9-13-23/h3-17H,1,18-20H2,2H3 |
| InChIKey | TUQOWJPPQLZOSO-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 85.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|