C20H17Cl4N3OS — CID 19638399
3-[1-(2,5-dichlorophenoxy)ethyl]-5-[(3,4-dichlorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole (PubChem CID 19638399) has the molecular formula C20H17Cl4N3OS and a molecular weight of 489.26 g/mol. Its IUPAC name is 3-[1-(2,5-dichlorophenoxy)ethyl]-5-[(3,4-dichlorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole.
| Compound Name | 3-[1-(2,5-dichlorophenoxy)ethyl]-5-[(3,4-dichlorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 19638399 |
| Molecular Formula | C20H17Cl4N3OS |
| Molecular Weight | 489.26 g/mol |
| Exact Mass | 486.98 |
| IUPAC Name | 3-[1-(2,5-dichlorophenoxy)ethyl]-5-[(3,4-dichlorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole |
| SMILES | C=CCn1c(SCc2ccc(Cl)c(Cl)c2)nnc1C(C)Oc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C20H17Cl4N3OS/c1-3-8-27-19(12(2)28-18-10-14(21)5-7-16(18)23)25-26-20(27)29-11-13-4-6-15(22)17(24)9-13/h3-7,9-10,12H,1,8,11H2,2H3 |
| InChIKey | XSJFSXZBZURLCE-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.26 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|