C20H18Cl2FN3OS — CID 19638397
3-[1-(2,5-dichlorophenoxy)ethyl]-5-[(3-fluorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole (PubChem CID 19638397) has the molecular formula C20H18Cl2FN3OS and a molecular weight of 438.36 g/mol. Its IUPAC name is 3-[1-(2,5-dichlorophenoxy)ethyl]-5-[(3-fluorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole.
| Compound Name | 3-[1-(2,5-dichlorophenoxy)ethyl]-5-[(3-fluorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 19638397 |
| Molecular Formula | C20H18Cl2FN3OS |
| Molecular Weight | 438.36 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | 3-[1-(2,5-dichlorophenoxy)ethyl]-5-[(3-fluorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole |
| SMILES | C=CCn1c(SCc2cccc(F)c2)nnc1C(C)Oc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C20H18Cl2FN3OS/c1-3-9-26-19(13(2)27-18-11-15(21)7-8-17(18)22)24-25-20(26)28-12-14-5-4-6-16(23)10-14/h3-8,10-11,13H,1,9,12H2,2H3 |
| InChIKey | ZOURRGUGJBUNPU-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.36 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|